![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Chain Reaction 3.0 - Cereal Killers (2009).pdf | 2022-11-15 22:14 | 369K | |
| How to Play THW.PDF | 2022-11-15 22:14 | 318K | |
| 2d6/ | 2022-11-19 11:29 | - | |
| FNG (Vietnam)/ | 2022-11-19 11:29 | - | |
| Black Powder/ | 2022-11-19 19:30 | - | |
| Fantasy/ | 2022-11-19 19:30 | - | |
| Free/ | 2022-11-19 23:22 | - | |
| Horror/ | 2022-11-19 23:22 | - | |
| Pulp/ | 2022-11-20 01:01 | - | |
| Western/ | 2022-11-20 02:43 | - | |
| World War 2/ | 2022-11-20 02:43 | - | |
| 5150/ | 2022-11-20 03:35 | - | |
| Ancient and Medieval/ | 2022-11-20 03:38 | - | |