![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 923 The Midderlands Colour HB FULL.jpg | 2022-11-19 00:22 | 18M | |
| 923 The Midderlands Colour HB GRID.jpg | 2022-11-19 00:22 | 16M | |
| 923 The Midderlands Colour HB VTT.jpg | 2022-11-19 00:21 | 15M | |
| 923 The Midderlands Parchment HB FULL.jpg | 2022-11-19 00:21 | 22M | |
| 923 The Midderlands Parchment HB GRID.jpg | 2022-11-19 00:19 | 21M | |
| 923 The Midderlands Parchment HB VTT.jpg | 2022-11-19 00:19 | 20M | |
| Map Corvendark FINAL r3.jpg | 2022-11-19 00:19 | 6.8M | |
| Map Northern Hollowreach FINAL r2.jpg | 2022-11-19 00:22 | 1.3M | |
| Map Old Mines FINAL r1.jpg | 2022-11-19 00:22 | 5.2M | |
| Map Structure A.jpg | 2022-11-19 00:22 | 244K | |
| Map Structure B.jpg | 2022-11-19 00:22 | 244K | |
| Map Structure C.jpg | 2022-11-19 00:22 | 324K | |
| Map The Midderlands North Staffershire.jpg | 2022-11-19 00:22 | 1.7M | |
| Map Wychington FINAL r3.jpg | 2022-11-19 00:22 | 4.0M | |
| Map of The Haven Isles 2018-06-28.jpg | 2022-11-19 00:22 | 16M | |
| Mood Art Beneath the Cottage 2018-06-28.jpg | 2022-11-19 00:22 | 2.5M | |
| Mood Art Poster 2018-06-28.jpg | 2022-11-19 00:22 | 25M | |
