![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Under Frozen Stars.pdf | 2022-11-18 23:35 | 4.8M | |
| Treasury of the Orient.pdf | 2022-11-18 23:35 | 2.3M | |
| The Way of Ki.pdf | 2022-11-18 23:35 | 3.9M | |
| The Baleful Coven.pdf | 2022-11-18 23:35 | 5.1M | |
| Road to Destiny.pdf | 2022-11-19 00:27 | 6.7M | |
| Meditations of the Imperial Mystics.pdf | 2022-11-19 00:27 | 2.4M | |
| Imperial Heroes - Pregenerated Characters.pdf | 2022-11-19 00:27 | 6.0M | |
| Beasts of Legend - Beasts of the East Pawns.pdf | 2022-11-19 00:27 | 5.1M | |
| Beasts of Legend - Beasts of the East.pdf | 2022-11-19 00:27 | 6.9M | |
| Asian Spell Compendium.pdf | 2022-11-19 00:27 | 16M | |
| Asian Archetypes - Martial.pdf | 2022-11-19 00:22 | 18M | |
| Asian Archetypes - Magical.pdf | 2022-11-19 00:22 | 20M | |