![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | d20PFSRD/ | 2022-11-19 14:24 | - | |
![[ ]](/icons/layout.gif) | Zombie Sky Press - The Faerie Ring - Dangerous Game.pdf | 2022-11-19 12:43 | 3.0M | |
| Zombie Sky Press - The Faerie Ring - Along the Twisting Way Campaign Guide.pdf | 2022-11-19 12:53 | 90M | |
| Zenith Games/ | 2022-11-19 13:15 | - | |
| Wordcasting Ent - Pugilist.pdf | 2022-11-19 12:53 | 2.5M | |
| Witherwind Games - SOLO-1 - The Merchant of Breckenwald.pdf | 2022-11-19 12:53 | 1.3M | |
| Wayward Rogue/ | 2022-11-19 14:30 | - | |
| Troll in the Corner/ | 2022-11-19 11:29 | - | |
| Tripod Machine/ | 2022-11-19 11:29 | - | |
| Tricky Owlbear/ | 2022-11-19 11:29 | - | |
| Timeout Diversions/ | 2022-11-19 11:29 | - | |
| The Shining Jewel - Legends of the Shining Jewel - Campaign Guide.pdf | 2022-11-19 12:53 | 4.8M | |
| The Legend of Larnshan's Wyrm.pdf | 2022-11-19 12:53 | 1.5M | |
| The Forgotten Tomb of Felgar the Goblin King - Pathfinder.pdf | 2022-11-19 12:53 | 6.0M | |
| The Curse of the Corpse Candle Cairn.pdf | 2022-11-19 12:53 | 1.5M | |
| The Creature Chronicle.pdf | 2022-11-19 12:53 | 11M | |
| The Book of Metal.pdf | 2022-11-19 12:21 | 53M | |
| Terran Empire - Manastorm World of Shinar.pdf | 2022-11-19 13:46 | 67M | |
| TPK Games/ | 2022-11-19 14:32 | - | |
| Super Genius Games/ | 2022-11-19 14:14 | - | |
| Sunburst Games - Realms of Atrothia - Legacy Races Revisited.pdf | 2022-11-19 14:27 | 15M | |
| Stranger Comics - Niobe.pdf | 2022-11-19 14:35 | 53M | |
| Storm Bunny/ | 2022-11-19 14:31 | - | |
| Stats for Jesus.pdf | 2022-11-19 00:29 | 5.0M | |
| Stardust/ | 2022-11-19 13:40 | - | |
| Spes Magna/ | 2022-11-19 14:14 | - | |
| Species Archive - The Kulvix PF1E.pdf | 2022-11-19 00:29 | 7.4M | |
| Species Archive - The Belaran PF1E.pdf | 2022-11-19 00:30 | 6.0M | |
| Soldier-Spy - Dragon Kings.pdf | 2022-11-19 00:28 | 3.7M | |
| Sneak Attack Press - Broken Earth.pdf | 2022-11-19 01:35 | 18M | |
| Smiling Bandit - The Moonshadow Murders.pdf | 2022-11-19 01:35 | 6.9M | |
| Smiling Bandit - Sorcerer Redesign.pdf | 2022-11-19 01:35 | 2.7M | |
| Skortched Urf' - Adventurer Essentials - True Alchemy.pdf | 2022-11-19 01:35 | 3.2M | |
| Skortched Urf' - Adventurer Essentials - Common Tongue.pdf | 2022-11-19 01:35 | 580K | |
| Skirmisher Publishing/ | 2023-05-07 01:58 | - | |
| Skirmisher - Insults & Injuries A Pathfinder Sourcebook for Medical Maladies.pdf | 2022-11-19 01:35 | 22M | |
| Silver Games LLC/ | 2022-11-19 11:29 | - | |
| Silver Games - The Ruinblade.pdf | 2022-11-19 00:43 | 4.3M | |
| Silver Crescent - Realms of Twilight - Campaign Setting.pdf | 2022-11-19 01:56 | 19M | |
| Sean K Reynolds - Darkness without Form - Secrets of the Mimic.pdf | 2022-11-19 01:56 | 3.4M | |
| Savage Mojo/ | 2022-11-19 11:29 | - | |
| Sasquatch/ | 2022-11-19 11:29 | - | |
| Sandy Petersen's Cthulhu Mythos.pdf | 2022-11-19 14:33 | 30M | |
| Sandy Petersen's Cthulhu Mythos - Silence from Sommerisk.pdf | 2022-11-19 14:31 | 3.5M | |
| Samurai Sheepdog/ | 2022-11-19 12:11 | - | |
| Samurai Sheepdog - The Book Of Many Things, Vol 2 - Shattered Worlds.pdf | 2022-11-19 13:13 | 11M | |
| Samurai Sheepdog - Lands of Theia [PF1].pdf | 2022-11-19 13:13 | 17M | |
| Sagawork Studios - WG1A - Rel-Draxa.pdf | 2022-11-19 13:13 | 18M | |
| Sagawork Studios - WG0 - Horror at Dagger Rock.pdf | 2022-11-15 21:24 | 3.1M | |
| S Werd Studios - A Murder Most Foul.pdf | 2022-11-15 21:24 | 7.7M | |
| S Werd Studios - A Bad Day at Creshman's Cove.pdf | 2022-11-15 21:24 | 4.7M | |
| S Werd Studios - 5 Days to Die.pdf | 2022-11-19 13:43 | 13M | |
| SHM Publishing - Voidling.pdf | 2022-11-19 01:56 | 1.1M | |
| SHM Publishing - Savage Company Campaign Setting (2020).pdf | 2022-11-19 01:56 | 20M | |
| SHM Publishing - Savage Company Campaign Setting (2019).pdf | 2022-11-19 01:56 | 3.9M | |
| Rusted Portal - Apocalypse the Risen Campaign Setting.pdf | 2022-11-19 13:43 | 97M | |
| Rusted Iron Games - Race Options Gillmen.pdf | 2022-11-19 01:32 | 3.1M | |
| Rusted Iron Games - Frozen Gardens Winter Special.pdf | 2022-11-19 01:32 | 5.5M | |
| Rusted Iron Games - Deadly Gardens Collection.pdf | 2022-11-19 01:32 | 11M | |
| Run Amok/ | 2022-11-19 12:27 | - | |
| Rogue Genius Games (RGG)/ | 2022-11-19 14:31 | - | |
| Rogue Genius - The Genius Guide to the Wildshaper.pdf | 2022-11-19 01:50 | 6.2M | |
| Robertson Games - Races of Atland, Simians.pdf | 2022-11-19 01:50 | 1.1M | |
| Rite Publishing/ | 2022-11-19 13:59 | - | |
| Rising Phoenix Games/ | 2022-11-19 13:48 | - | |
| Red Star/ | 2022-11-19 11:29 | - | |
| Reality Cheque - Dravakor Campaign Primer.pdf | 2022-11-19 01:50 | 17M | |
| Rare and Mystical Tomes 13.pdf | 2022-11-19 12:37 | 18M | |
| Rare and Mystical Tomes 11.pdf | 2022-11-19 12:37 | 18M | |
| Rare and Mystical Tomes 10.pdf | 2022-11-19 12:37 | 5.9M | |
| Rare and Mystical Tomes 9.pdf | 2022-11-19 02:00 | 540K | |
| Rare and Mystical Tomes 8.pdf | 2022-11-19 02:00 | 5.9M | |
| Rare and Mystical Tomes 7.pdf | 2022-11-19 02:00 | 5.9M | |
| Rare and Mystical Tomes 6.pdf | 2022-11-19 02:00 | 5.9M | |
| Rare and Mystical Tomes 5.pdf | 2022-11-19 02:00 | 5.1M | |
| Rare and Mystical Tomes 4.pdf | 2022-11-19 01:59 | 5.0M | |
| Rare and Mystical Tomes 3.pdf | 2022-11-19 00:24 | 5.9M | |
| Rare and Mystical Tomes 1.pdf | 2022-11-19 00:24 | 5.1M | |
| Raging Swan Press/ | 2022-11-19 13:52 | - | |
| Radiance House/ | 2022-11-19 11:29 | - | |
| RPG - Terah Within Wheels - Arc 1.1 Pebble in the Pond.pdf | 2022-11-19 01:50 | 4.0M | |
| Quasar Knight - Nice Things For Fighters.pdf | 2022-11-19 00:24 | 1.0M | |
| Quasar Knight - Abstract Thief.pdf | 2022-11-19 00:24 | 551K | |
| Pyromaniac Press/ | 2022-11-19 14:22 | - | |
| Purple Duck Games/ | 2022-11-19 11:29 | - | |
| Playground Adventures/ | 2022-11-19 14:10 | - | |
| Planewalker Adventures - Celestian's Compass.pdf | 2022-11-19 00:24 | 7.7M | |
| Peryton Publishing - Pits of Paneris.pdf | 2022-11-19 00:24 | 2.7M | |
| Pelgrane Press/ | 2022-11-19 12:57 | - | |
| Pathfinder Super Retro Sourcebook Vol. 2.pdf | 2022-11-19 00:24 | 2.2M | |
| Party of 1/ | 2022-11-19 14:01 | - | |
| Panik Productions/ | 2022-11-19 14:01 | - | |
| Pact Magic/ | 2022-11-19 11:29 | - | |
| Outside Normal - Psionics Transcended The Power of Ki.pdf | 2022-11-19 00:24 | 2.0M | |
| Otherverse Games/ | 2022-11-19 14:12 | - | |
| Onyx Path/ | 2022-11-19 14:13 | - | |
| Ondine - Whispers of the Dark Daeva.pdf | 2022-11-19 00:24 | 2.5M | |
| Octopus Apocalypse/ | 2022-11-19 14:13 | - | |
| Northwinter Press/ | 2022-11-19 13:27 | - | |
| Nick Herold's Creature Codex, Vol. 1 - Monsters of Twilight.pdf | 2023-05-07 01:55 | 3.3M | |
| Neo Productions Unlimited/ | 2022-11-19 13:14 | - | |
| Necromancers of the Northwest/ | 2022-11-19 14:30 | - | |
| Names Games - 2019 Exclusive Collection.pdf | 2023-05-07 01:55 | 24M | |
| Mongoose - Van Graaf's Journal of Dragons.pdf | 2023-05-07 02:13 | 16M | |
| Mistfinder.pdf | 2023-05-07 02:13 | 1.6M | |
| Misfit Studios/ | 2022-11-19 12:44 | - | |
| Minotaur Games/ | 2022-11-19 12:44 | - | |
| Millennium - Heroes from Earth - Book 1 Nemoria.pdf | 2022-11-19 14:13 | 94M | |
| Metric Conversion Guide.pdf | 2022-11-19 14:13 | 1.1M | |
| Metal & Myth - Dredan, Realm of Metal & Myth.pdf | 2022-11-19 14:13 | 16M | |
| Mechanical Muse/ | 2022-11-19 11:29 | - | |
| Mazur's Machinations - Adventurers Addendum I.pdf | 2022-11-19 02:00 | 2.0M | |
| MDB Publishing - The Demon Stones.pdf | 2022-11-15 21:31 | 14M | |
| M.r Games - Imperiums Campaign - Guide Plight of the Tuatha.pdf | 2022-11-19 00:33 | 22M | |
| Mór Games - Imperiums Campaign - Guide Plight of the Tuatha.pdf | 2023-05-07 02:13 | 22M | |
| Louis Porter Jr. Design/ | 2022-11-19 14:29 | - | |
| Lost Temple of Forgotten Evil - Illustration Book v2.pdf | 2022-11-19 02:00 | 3.8M | |
| Lost Spheres/ | 2022-11-19 11:29 | - | |
| Little Red Goblin/ | 2022-11-19 14:33 | - | |
| Legendary Games/ | 2022-11-19 11:29 | - | |
| Lee's List - 100 Male Gnome Names.pdf | 2022-11-19 02:00 | 132K | |
| Lee's List - 100 Cantrips.pdf | 2022-11-19 02:00 | 435K | |
| Kyoudai/ | 2022-11-19 14:13 | - | |
| KromeDragon Games/ | 2022-11-19 11:29 | - | |
| Krewe of Harpocrates Publications/ | 2022-11-19 13:17 | - | |
| Kobold Press - Open Design/ | 2022-11-19 13:36 | - | |
| Kobold Death Maze - Pathfinder.pdf | 2022-11-19 02:01 | 5.6M | |
| Knotty-Works/ | 2022-11-19 14:33 | - | |
| Knotty-Works - Full Frontal Archetypes Barbarian.pdf | 2022-11-19 11:42 | 50M | |
| Kettle of Fish - The Talented Rogues Guide to Rogue Talents Vol 1.pdf | 2022-11-19 11:41 | 2.0M | |
| Kettle of Fish - The Meddlers Multipurpose Maps Cavern of The Crimson Cult.pdf | 2022-11-19 12:56 | 2.8M | |
| KD1 - The Gift, Pt 1 - Gaijin.pdf | 2022-11-19 12:56 | 7.4M | |
| Just Insert Imagination/ | 2022-11-19 13:23 | - | |
| Jon Brazer Enterprises/ | 2022-11-19 14:28 | - | |
| John Wick/ | 2022-11-19 11:29 | - | |
| Jetpack 7 - Gods and Goddesses Pathfinder Conversion.pdf | 2022-11-19 12:56 | 7.3M | |
| Interjection Games/ | 2022-11-19 13:54 | - | |
| Infinium/ | 2022-11-19 14:13 | - | |
| Infinium - Monsters of Aquilae, Bloodguise Diredamsel.pdf | 2022-11-19 12:56 | 3.4M | |
| IPG - Kingdoms of Legend - World Guide.pdf | 2022-11-19 12:56 | 3.3M | |
| IPG - Kingdoms of Legend - Relics of the Lost Gods, Pt 1 - Hidden Threat.pdf | 2022-11-19 12:56 | 3.9M | |
| ICOSA/ | 2022-11-19 14:11 | - | |
| Highmoon Games - Liber Sodalitas - Dream Healers.pdf | 2022-11-19 12:56 | 1.8M | |
| Higher Grounds - Super Retro Sourcebook Vol 1.pdf | 2022-11-19 12:56 | 2.2M | |
| Higher Grounds - Hybrid Class - Blade-Siren.pdf | 2022-11-19 12:55 | 4.7M | |
| High Level Games - Kumari Nights.pdf | 2022-11-19 01:47 | 4.8M | |
| High Level Games - Cat's Meow A One Page Adventure.pdf | 2022-11-19 01:47 | 3.4M | |
| Heroic Journey Publishing - Eldritch Races - Runeborn.pdf | 2022-11-19 01:47 | 1.2M | |
| Henry Hakl - Monk Unfettered.pdf | 2022-11-19 01:47 | 19M | |
| Heartbreaker Press - Red Dawn v2.pdf | 2022-11-19 12:33 | 3.0M | |
| Headless Hydra - Viridian Legacy - Gamemaster's Guide.pdf | 2022-11-19 12:33 | 35M | |
| Headless Hydra - Eldritch Secrets, Vol 1.pdf | 2022-11-19 11:56 | 36M | |
| Hardy Tales - Lords of Westmoor.pdf | 2022-11-19 02:00 | 6.1M | |
| Hammerdog Games/ | 2022-11-19 12:31 | - | |
| Gun Metal Games/ | 2022-11-19 11:29 | - | |
| Gruppo Chimera - The Legend of the Mist Flowers.pdf | 2022-11-19 14:34 | 21M | |
| Griffon Lore - Curse of the Lost Memories.pdf | 2022-11-19 14:34 | 65M | |
| Green Ronin/ | 2022-11-19 14:01 | - | |
| Graemation Ltd. - Orc War, The Mother Dog Saga - Savage Weaponry.pdf | 2022-11-19 14:00 | 6.2M | |
| Goodman Games/ | 2022-11-19 14:30 | - | |
| Goodevil Press - Paths Less Traveled The Amazon.pdf | 2022-11-19 14:00 | 4.2M | |
| Golden Glyph - Races, The Lagos.pdf | 2022-11-19 14:00 | 440K | |
| Goblin Stone - The Chapel on the Cliffs.pdf | 2022-11-19 14:00 | 7.7M | |
| Glen Publishing - The Gardener Base Class.pdf | 2022-11-19 14:00 | 3.6M | |
| Giant Dragons - Secrets of Giant Dragons The Minotaur.pdf | 2022-11-19 14:00 | 249K | |
| Geek Industrial Complex/ | 2022-11-19 13:10 | - | |
| Gaming Paper - Fractured Phylactery.pdf | 2022-11-19 14:00 | 7.7M | |
| Gaming Paper - Edgewaters Folly.pdf | 2022-11-19 00:05 | 5.6M | |
| Gaming Paper - Citadel of Pain.pdf | 2022-11-19 12:15 | 50M | |
| Gaming Ballistic - Dungeon Grappling.pdf | 2022-11-19 12:14 | 7.8M | |
| Game Room Creations/ | 2022-11-19 13:10 | - | |
| Frog God Games/ | 2022-11-19 14:03 | - | |
| Friends of Eldoria/ | 2022-11-19 14:18 | - | |
| Forrestfire Studios/ | 2022-11-19 12:37 | - | |
| Forest Guardian Press/ | 2022-11-19 11:29 | - | |
| Flying Pincushion/ | 2022-11-19 13:54 | - | |
| Flaming Crab/ | 2022-11-19 14:32 | - | |
| Fireinthedust Productions - Dungeon of the Dragon Master.pdf | 2022-11-19 01:54 | 18M | |
| Fire Mountain/ | 2022-11-19 14:32 | - | |
| Fat Goblin Games/ | 2022-11-19 14:19 | - | |
| Fat Dragon - Dragonlore, Thousand Maw.pdf | 2022-11-19 01:54 | 4.9M | |
| FOE/ | 2022-11-19 11:29 | - | |
| Expeditious Retreat Press - Malevolent and Benign.pdf | 2022-11-19 13:05 | 11M | |
| Expedition to Dungeonland.pdf | 2022-11-19 13:05 | 4.6M | |
| Everyman/ | 2022-11-19 13:54 | - | |
| Everybody Games/ | 2022-11-19 13:12 | - | |
| Epidemic Books - Oathbound Eclipse - Director's Cut.pdf | 2022-11-19 13:04 | 53M | |
| Epidemic - Oathbound Bestiary.pdf | 2022-11-19 12:31 | 55M | |
| Epic Level NPC/ | 2022-11-19 13:11 | - | |
| Embers Design Studios/ | 2022-11-19 11:29 | - | |
| Embers Design Studios - Yrisa's Nightmare.pdf | 2022-11-19 12:31 | 10M | |
| Eldritch Dream/ | 2022-11-19 14:11 | - | |
| EN Publishing/ | 2022-11-19 11:29 | - | |
| EGD - Polyhedral Pantheons Worksheets.pdf | 2022-11-19 01:58 | 4.8M | |
| EGD - Polyhedral Pantheons.pdf | 2022-11-19 01:58 | 4.5M | |
| Dyslexic Studeos - Pathfinder Character Sheets.pdf | 2022-11-19 01:58 | 2.3M | |
| Dungeon A Day/ | 2022-11-19 14:26 | - | |
| Duck n Roll Games - The Flavour Handbook.pdf | 2022-11-19 01:58 | 32M | |
| Drop Dead Studios/ | 2022-11-19 14:08 | - | |
| Dreamscarred Press/ | 2022-11-19 11:29 | - | |
| Dreadfox Games/ | 2022-11-19 14:21 | - | |
| Dragondyne/ | 2022-11-19 14:21 | - | |
| DragonWing Games - Torn Asunder, Critical Hits.pdf | 2022-11-19 01:57 | 28M | |
| DragonWing - Lore of the Gods.pdf | 2022-11-19 13:30 | 98M | |
| Dire Corgi - Rcane's Guide to Fantastic Races The Metallic Dragon Descended (PF).pdf | 2022-11-19 12:58 | 6.9M | |
| Dire Corgi - Rcane's Guide to Fantastic Races The Chromatic Dragon Descended (Pathfinder).pdf | 2022-11-19 12:57 | 10M | |
| Dias Ex Machina Games/ | 2022-11-19 12:34 | - | |
| Devil.s Workshop/ | 2023-05-05 18:10 | - | |
| Devil...s Workshop/ | 2023-05-05 18:10 | - | |
| Devil’s Workshop/ | 2023-05-07 00:52 | - | |
| Devilâs Workshop/ | 2023-05-07 00:17 | - | |
| Demiurge Press - Creature Codex Volume 2 - Infernal Index.pdf | 2022-11-19 12:57 | 3.3M | |
| Darklight Interactive - The Dragons Master.pdf | 2022-11-19 13:00 | 4.4M | |
| Darklight Interactive - Cavern of the Damned.pdf | 2022-11-19 13:00 | 40M | |
| Dark by Dezign/ | 2022-11-19 14:34 | - | |
| Darakin Studios - WarMage.pdf | 2022-11-15 21:50 | 124K | |
| Darakin Studios - The Bard of Shadows.pdf | 2022-11-15 21:50 | 191K | |
| Darakin Studios - Soul Eater.pdf | 2022-11-15 21:50 | 220K | |
| DEM - Amethyst - Factions.pdf | 2022-11-19 13:00 | 43M | |
| Crystal Frasier - Hirelings, Into the Wild.pdf | 2022-11-15 21:50 | 919K | |
| Conflict Games - Conflict Roleplaying Rulebook.pdf | 2022-11-19 13:57 | 34M | |
| Colossal Creatures Bestiary.pdf | 2022-11-19 13:57 | 17M | |
| Cobalt Sages Creations - The Stormbound.pdf | 2022-11-19 13:09 | 3.7M | |
| Cobalt Sages Creations - Aberrant Codex, Aberrant Allies.pdf | 2022-11-19 13:09 | 9.6M | |
| Clockwork Golem - Magic Merchants 1 - House of the Transformed Toad.pdf | 2022-11-19 13:09 | 5.4M | |
| Clockwork Gnome Publishing/ | 2022-11-19 12:40 | - | |
| City of 7 Seraphs - Lost Paths - Voltaic 1.0.pdf | 2022-11-19 13:09 | 1.9M | |
| Chronica - Age of Exploration.pdf | 2022-11-19 13:17 | 95M | |
| Chamomile Has Adventures - Petals and Thorns Strangers in Ramshorn.pdf | 2022-11-19 13:00 | 45M | |
| Calidar - CAL1 In Stranger Skies.pdf | 2022-11-19 12:59 | 12M | |
| Broken Earth/ | 2022-11-19 13:39 | - | |
| Bloodstone Press/ | 2022-11-19 13:39 | - | |
| Blackbyrne Publishing/ | 2022-11-19 13:39 | - | |
| Black Flame Studios/ | 2022-11-19 12:43 | - | |
| Azukail Games - A Baker's Dozen of Witch Hexes.pdf | 2022-11-19 12:58 | 2.0M | |
| Azukail Games - A Baker's Dozen of Ioun Stones.pdf | 2022-11-19 12:58 | 4.5M | |
| Avalon Games/ | 2022-11-19 12:55 | - | |
| Aussie Critters for Pathfinder.pdf | 2022-11-19 00:42 | 3.0M | |
| Asparagus Jumpsuit/ | 2022-11-19 12:55 | - | |
| Ascension Games - Path of the Wilds.pdf | 2022-11-19 00:42 | 25M | |
| Ascension Games - Path of Shadows.pdf | 2022-11-19 14:30 | 11M | |
| Ascension - Path of Iron.pdf | 2022-11-19 14:30 | 23M | |
| Arjade Productions - Saraahd's Secret Shrine.pdf | 2022-11-19 14:32 | 7.1M | |
| Argoss Press - Liber Ingenium.pdf | 2022-11-19 14:32 | 5.7M | |
| Arcane Ki - The Magic of Martial Artists.pdf | 2022-11-19 14:32 | 1.0M | |
| Anthro Adventures/ | 2022-11-19 13:19 | - | |
| Amora Games/ | 2022-11-19 12:26 | - | |
| Alluria Campaign Setting Guide.pdf | 2022-11-19 14:32 | 9.0M | |
| Alluria/ | 2022-11-19 12:25 | - | |
| Alea Publishing - Insanity Rules.pdf | 2022-11-19 14:32 | 3.5M | |
| Akashic Realms Volume 2 - The Quiet Lands.pdf | 2022-11-19 14:32 | 8.0M | |
| Akasha Reshaped - Moon and Tides.pdf | 2022-11-19 13:05 | 18M | |
| Aetheric Dreams - Nights of the Crusades.pdf | 2022-11-19 13:05 | 19M | |
| Aeon Forge/ | 2022-11-19 11:29 | - | |
| Adventure a Week/ | 2022-11-19 14:29 | - | |
| Adamant/ | 2022-11-19 14:19 | - | |
| Accessible Games - Diviner's Dissertation.pdf | 2022-11-15 20:40 | 2.3M | |
| Absolute Tabletop/ | 2022-11-19 14:19 | - | |
| Above Average Creations/ | 2022-11-19 14:19 | - | |
| Abandoned Arts/ | 2022-11-19 14:19 | - | |
| AGES Gaming/ | 2022-11-19 11:29 | - | |
| 500 Penny Design - A Simple Character Sheet.pdf | 2022-11-15 20:40 | 1.3M | |
| 100 Encounters for Fantasy Oceans {AGPFF0015}.pdf | 2022-11-15 20:40 | 466K | |
| 10 Encounters (Ladies of the Evening), Book 4 [PF1].pdf | 2022-11-15 20:40 | 2.0M | |
| 10 Encounters (Ladies of the Evening), Book 3 [PF1].pdf | 2022-11-15 20:40 | 2.5M | |
| 10 Encounters (Ladies of the Evening), Book 2 [PF1].pdf | 2022-11-15 20:40 | 1.8M | |
| 10 Encounters (Ladies of the Evening), Book 1 [PF1].pdf | 2022-11-15 20:40 | 1.7M | |
| 4 Winds/ | 2022-11-19 11:45 | - | |
| 4/ | 2022-11-19 14:33 | - | |
| 4$d/ | 2022-11-19 13:07 | - | |
| 1 on 1 Adventures/ | 2022-11-19 13:50 | - | |
| 0one/ | 2022-11-19 12:43 | - | |
|
|---|