![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Mirrors of the Abyss.7z | 2022-11-19 00:15 | 932M | |
![[ ]](/icons/unknown.gif) | The Perfumers Daughter.7z | 2022-11-19 11:47 | 240M | |
![[ ]](/icons/layout.gif) | Book of Dragons II.pdf | 2022-11-19 12:05 | 158M | |
![[ ]](/icons/unknown.gif) | What Happened to Evy Ashwood - Incl. Old One Compendium (5e).7z | 2022-11-19 12:56 | 155M | |
![[ ]](/icons/unknown.gif) | Goldenfields - Amber Waves of Grain.7z | 2022-11-19 12:55 | 149M | |
![[ ]](/icons/layout.gif) | Argols Comprehensive Guide to Infrastructure v3.5.pdf | 2022-11-19 12:56 | 138M | |
![[ ]](/icons/compressed.gif) | Players Guide to Faerun Heraldry Art.zip | 2022-11-19 11:41 | 126M | |
![[ ]](/icons/layout.gif) | Book of Dragons.pdf | 2022-11-19 00:02 | 122M | |
![[ ]](/icons/unknown.gif) | Clyde Blackthornes Book of Rogues.7z | 2023-05-07 02:52 | 94M | |
![[ ]](/icons/layout.gif) | Tome of Warfare.pdf | 2022-11-19 00:00 | 84M | |
![[ ]](/icons/unknown.gif) | Encounters in Icewind Dale.7z | 2022-11-19 12:56 | 82M | |
![[ ]](/icons/layout.gif) | Sir Alkian.s Guide to Surviving the Apocalypse.pdf | 2022-11-19 00:06 | 67M | |
![[ ]](/icons/layout.gif) | Sir Alkian’s Guide to Surviving the Apocalypse.pdf | 2023-05-07 02:28 | 67M | |
![[ ]](/icons/layout.gif) | Fulvanos Guide to the Wilds v1.0.1.pdf | 2022-11-18 23:53 | 60M | |
![[ ]](/icons/unknown.gif) | The Shanty of Boldbeards Pride.7z | 2022-11-19 00:06 | 58M | |
![[ ]](/icons/layout.gif) | Magical Potion and Ingredients v.11.pdf | 2022-11-15 22:45 | 55M | |
![[ ]](/icons/layout.gif) | A Plethora of Paladins Plus Some.pdf | 2022-11-19 00:02 | 54M | |
![[ ]](/icons/compressed.gif) | Death by Goblins Maps.zip | 2022-11-18 23:54 | 54M | |
![[ ]](/icons/layout.gif) | Hedges & Highways.pdf | 2022-11-19 01:08 | 49M | |
![[ ]](/icons/layout.gif) | The Lamenting Lighthouse v2.pdf | 2022-11-15 23:06 | 40M | |
![[ ]](/icons/layout.gif) | Plants and Fungi of the Realms.pdf | 2022-11-19 11:41 | 34M | |
![[ ]](/icons/layout.gif) | Mock - A Monsterious Race of Mimickry and Never Ending Hunger v1.2.1.pdf | 2022-11-15 23:05 | 32M | |
![[ ]](/icons/layout.gif) | The Beast of Graenseskov v0.3.pdf | 2022-11-18 23:52 | 31M | |
![[ ]](/icons/layout.gif) | Eberron Battlemaps - Lightning Rail.pdf | 2022-11-19 12:56 | 29M | |
![[ ]](/icons/layout.gif) | Eldeen Ranger.pdf | 2022-11-19 12:56 | 29M | |
![[ ]](/icons/layout.gif) | Foul Mouth Primal Path DMs Bundle.pdf | 2023-05-07 01:16 | 29M | |
![[ ]](/icons/layout.gif) | Gimbles Guide to the Feywild.pdf | 2022-11-19 00:06 | 28M | |
![[ ]](/icons/layout.gif) | Storm Over Purple Rocks.pdf | 2023-05-07 00:18 | 27M | |
![[ ]](/icons/layout.gif) | A Requiem of Wings - A Night of Mask and Monsters.pdf | 2022-11-19 00:15 | 27M | |
![[ ]](/icons/layout.gif) | Comprehensive Animal Handling Manual [5e] [DMs Guild].pdf | 2023-05-07 02:19 | 26M | |
![[ ]](/icons/layout.gif) | The Book of Dragons.pdf | 2022-11-15 21:04 | 25M | |
![[ ]](/icons/unknown.gif) | The High Moors - Maps.7z | 2022-11-15 22:49 | 22M | |
![[ ]](/icons/layout.gif) | Masquerade de Lolth.pdf | 2022-11-15 21:00 | 22M | |
![[ ]](/icons/layout.gif) | The Weaver v1.1.pdf | 2022-11-18 23:50 | 21M | |
![[ ]](/icons/layout.gif) | Golemancy.pdf | 2022-11-19 00:06 | 20M | |
![[ ]](/icons/layout.gif) | The Ravens Rocks - A Saltmarsh Encounter.pdf | 2022-11-15 22:45 | 19M | |
![[ ]](/icons/layout.gif) | Journey Into the Feywild.pdf | 2022-11-15 21:35 | 18M | |
![[ ]](/icons/layout.gif) | Lands, Lords, and Ladies v2.pdf | 2022-11-15 23:07 | 17M | |
![[ ]](/icons/layout.gif) | Grimalkin Race v2.pdf | 2022-11-19 00:06 | 17M | |
![[ ]](/icons/layout.gif) | Haven Cross Adventurers Guild v1p3.pdf | 2022-11-15 21:34 | 16M | |
![[ ]](/icons/unknown.gif) | Mythic Actions - Colossus Maps.7z | 2022-11-15 23:05 | 15M | |
![[ ]](/icons/layout.gif) | Dont Die in the Jungle.pdf | 2022-11-19 12:56 | 15M | |
![[ ]](/icons/layout.gif) | The Wyrmling Playable Dragons.pdf | 2022-11-18 23:50 | 15M | |
![[ ]](/icons/layout.gif) | Epic Level Characters level 21-40.pdf | 2023-05-07 00:54 | 14M | |
![[ ]](/icons/layout.gif) | Fulvanos Guide to the Wilds v1.01.pdf | 2022-11-18 23:53 | 14M | |
![[ ]](/icons/layout.gif) | Naturalists Guide to Eberron - Volume One.pdf | 2022-11-18 23:48 | 14M | |
![[ ]](/icons/layout.gif) | Zombie Wizards Of Greesly Keep.pdf | 2022-11-19 00:06 | 14M | |
![[ ]](/icons/layout.gif) | The Rise of the Necromancer.pdf | 2022-11-15 22:45 | 13M | |
![[ ]](/icons/layout.gif) | Autumns Armory.pdf | 2022-11-18 23:57 | 13M | |
![[ ]](/icons/layout.gif) | Harrowings From the Rime - Issue 01, 2019.pdf | 2022-11-15 21:50 | 13M | |
![[ ]](/icons/layout.gif) | Labyrinth of Thorns.pdf | 2022-11-15 23:06 | 13M | |
![[ ]](/icons/layout.gif) | Waters Above - Rules for Adventuring in the Astral Plane.pdf | 2022-11-18 23:47 | 13M | |
![[ ]](/icons/layout.gif) | The Forgotten Forge - Conversion Guide.pdf | 2022-11-19 12:56 | 13M | |
![[ ]](/icons/layout.gif) | The Banshee of Barovia.pdf | 2022-11-15 22:18 | 12M | |
![[ ]](/icons/layout.gif) | Booms Heals and Bleedings Bombs Alchemy and Poisons.pdf | 2022-11-19 00:02 | 12M | |
![[ ]](/icons/layout.gif) | Adventurous Archetypes Vol 1 Ver 1.21.pdf | 2022-11-15 22:57 | 12M | |
![[ ]](/icons/layout.gif) | Joy of Monster Cooking.pdf | 2022-11-15 21:35 | 11M | |
![[ ]](/icons/layout.gif) | Construct Compendium.pdf | 2023-05-07 02:19 | 11M | |
![[ ]](/icons/layout.gif) | Tome of Battle - The Book of Nine Swords.pdf | 2022-11-15 22:28 | 11M | |
![[ ]](/icons/layout.gif) | College of the Opera.pdf | 2023-05-07 01:56 | 11M | |
![[ ]](/icons/layout.gif) | The Scimitar Spires.pdf | 2022-11-15 22:08 | 11M | |
![[ ]](/icons/layout.gif) | A Going Concern.pdf | 2022-11-19 00:02 | 11M | |
![[ ]](/icons/layout.gif) | Balasars Guide to Exploration.pdf | 2022-11-18 23:57 | 11M | |
![[ ]](/icons/layout.gif) | Lycanthrope Werewolf Class v2.0.pdf | 2022-11-15 22:46 | 11M | |
![[ ]](/icons/layout.gif) | Couriers Guide to Offspring.pdf | 2022-11-15 22:50 | 11M | |
![[ ]](/icons/layout.gif) | Malady Codex.pdf | 2022-11-15 22:12 | 11M | |
![[ ]](/icons/layout.gif) | Advanced Arcana v1.2.pdf | 2022-11-15 22:57 | 9.8M | |
![[ ]](/icons/layout.gif) | Fear and Loathing in Faer.n.pdf | 2022-11-15 23:06 | 9.8M | |
![[ ]](/icons/layout.gif) | Fear and Loathing in Faerûn.pdf | 2023-05-07 01:16 | 9.8M | |
![[ ]](/icons/layout.gif) | Encounters in the Mournland.pdf | 2022-11-18 23:58 | 9.7M | |
![[ ]](/icons/layout.gif) | Saltmarsh Ship Stats Sheet.pdf | 2022-11-19 00:35 | 9.6M | |
![[ ]](/icons/layout.gif) | The Heist at Nimressa v1.pdf | 2022-11-19 12:56 | 9.6M | |
![[ ]](/icons/layout.gif) | A Sound of Many Faces.pdf | 2022-11-19 00:15 | 9.5M | |
![[ ]](/icons/layout.gif) | Denizens of Waterdeep - Backgrounds for a Heist.pdf | 2022-11-15 20:51 | 9.2M | |
![[ ]](/icons/layout.gif) | Krillos Guide To Alchemy.pdf | 2022-11-15 21:35 | 9.0M | |
![[ ]](/icons/layout.gif) | Dreadful Villains and the Depths They Dwell.pdf | 2022-11-19 12:56 | 8.9M | |
![[ ]](/icons/layout.gif) | Mousefolk Character Options.pdf | 2022-11-15 23:05 | 8.8M | |
![[ ]](/icons/layout.gif) | The Friend Folio II.pdf | 2022-11-19 12:56 | 8.7M | |
![[ ]](/icons/layout.gif) | Waterdeep Dragon Heist - Infernal Contract.pdf | 2022-11-19 00:00 | 8.5M | |
![[ ]](/icons/layout.gif) | Twisted Mithral - Cart Combat.pdf | 2022-11-19 00:00 | 8.2M | |
![[ ]](/icons/layout.gif) | A Thousand Classes A Thousand More v1.1.pdf | 2022-11-19 00:15 | 8.2M | |
![[ ]](/icons/layout.gif) | Christopher Greys Factions.pdf | 2023-05-07 00:57 | 7.9M | |
![[ ]](/icons/layout.gif) | The Balov - A Horror Film Inspired Halloween Adventure.pdf | 2022-11-15 22:18 | 7.8M | |
![[ ]](/icons/layout.gif) | Master of Death.pdf | 2022-11-15 21:00 | 7.6M | |
![[ ]](/icons/layout.gif) | Heroes of Shadow 5e v1.4.pdf | 2022-11-19 01:08 | 7.6M | |
![[ ]](/icons/layout.gif) | Team Attacks A Homebrew System for Teamwork.pdf | 2022-11-18 23:51 | 7.4M | |
![[ ]](/icons/layout.gif) | The Primal Gith - A Lost Race Rediscovered.pdf | 2022-11-15 22:45 | 7.4M | |
![[ ]](/icons/layout.gif) | DM Screen Inserts.pdf | 2022-11-15 20:51 | 7.0M | |
![[ ]](/icons/layout.gif) | The Crucible (One Shot Adventure).pdf | 2022-11-15 21:45 | 6.9M | |
![[ ]](/icons/layout.gif) | Deck the Dungeons.pdf | 2022-11-18 23:54 | 6.9M | |
![[ ]](/icons/layout.gif) | Werewolf Class v1.5.pdf | 2022-11-18 23:47 | 6.8M | |
![[ ]](/icons/layout.gif) | Crafters Manual v1.1 .pdf | 2022-11-15 22:50 | 6.7M | |
![[ ]](/icons/layout.gif) | Pilgrims of the Grave, The Emerald Legacy Part 1.pdf | 2022-11-15 22:15 | 6.5M | |
![[ ]](/icons/layout.gif) | The NPC Cookbook-Instant NPCs Just Add Dice.pdf | 2022-11-15 22:15 | 6.5M | |
![[ ]](/icons/layout.gif) | Trouble in Ironboot Mine - Pt 1 The Aranea Queen.pdf | 2022-11-19 00:00 | 6.5M | |
![[ ]](/icons/layout.gif) | Guide of the Damned.pdf | 2022-11-15 21:50 | 6.4M | |
![[ ]](/icons/layout.gif) | Lithins Medicine Cabinet.pdf | 2022-11-15 23:07 | 6.4M | |
![[ ]](/icons/layout.gif) | The Friend Folio.pdf | 2022-11-19 12:56 | 6.4M | |
![[ ]](/icons/layout.gif) | The Feystone Shards.pdf | 2022-11-15 21:45 | 6.3M | |
![[ ]](/icons/layout.gif) | Wizard - School of Summoning.pdf | 2022-11-15 21:03 | 6.2M | |
![[ ]](/icons/layout.gif) | The Siverain Order v1.1.pdf | 2022-11-15 23:10 | 6.2M | |
![[ ]](/icons/layout.gif) | Azals Tome of Race Creation.pdf | 2022-11-18 23:57 | 6.0M | |
![[ ]](/icons/layout.gif) | Expanded Armoury.pdf | 2023-05-07 00:54 | 5.8M | |
![[ ]](/icons/layout.gif) | The Bard - Keeping It Classy.pdf | 2022-11-18 23:52 | 5.7M | |
![[ ]](/icons/layout.gif) | A D&D Tavern Menu 2.pdf | 2022-11-15 21:44 | 5.7M | |
![[ ]](/icons/layout.gif) | New Character Class - Chemist.pdf | 2022-11-18 23:48 | 5.6M | |
![[ ]](/icons/layout.gif) | Terror of the Bleak Woods.pdf | 2022-11-18 23:51 | 5.6M | |
![[ ]](/icons/layout.gif) | An Exercise in Worldbuilding.pdf | 2022-11-19 11:55 | 5.5M | |
![[ ]](/icons/layout.gif) | Old School Hacks Vol 1 Hexcrawling - Wilderness Exploration and Random Encounters.pdf | 2022-11-18 23:48 | 5.4M | |
![[ ]](/icons/compressed.gif) | Czepeku Frostgauntlet Maps.zip | 2022-11-15 22:50 | 5.4M | |
![[ ]](/icons/layout.gif) | Chronomancer Class.pdf | 2023-05-07 00:57 | 5.4M | |
![[ ]](/icons/layout.gif) | The Book of Ki.pdf | 2022-11-15 21:45 | 5.3M | |
![[ ]](/icons/layout.gif) | Khybers Cursed - Case Studies of Eberrons Aberrant Dragonmarks.pdf | 2022-11-15 21:35 | 5.3M | |
![[ ]](/icons/layout.gif) | Gith Handbook.pdf | 2022-11-19 00:06 | 5.0M | |
![[ ]](/icons/layout.gif) | Prison Escape.pdf | 2022-11-15 22:01 | 5.0M | |
![[ ]](/icons/unknown.gif) | Murder on the Eberron Express - Character Creation Options.7z | 2022-11-15 23:05 | 4.9M | |
![[ ]](/icons/layout.gif) | Cannith Wand Adept of Eberron (5e Conversion).pdf | 2022-11-18 23:50 | 4.8M | |
![[ ]](/icons/layout.gif) | Book of Vile Darkness.pdf | 2022-11-19 00:02 | 4.6M | |
![[ ]](/icons/layout.gif) | Manual of Masks.pdf | 2022-11-15 22:12 | 4.5M | |
![[ ]](/icons/layout.gif) | Heart Hunt.pdf | 2022-11-15 21:34 | 4.5M | |
![[ ]](/icons/layout.gif) | Sorcerous Origin, Ghost-Touched v1.1.pdf | 2023-05-07 00:18 | 4.4M | |
![[ ]](/icons/layout.gif) | Sorcerous Origin - Ghost-Touched.pdf | 2023-05-07 00:17 | 4.4M | |
![[ ]](/icons/layout.gif) | I had to go Because - Options For Sporadic Players v1.01.pdf | 2022-11-15 21:35 | 4.4M | |
![[ ]](/icons/layout.gif) | Circle of the Swarm.pdf | 2023-05-07 00:57 | 4.3M | |
![[ ]](/icons/compressed.gif) | Sword Coast Hex Map - Hexographer.zip | 2022-11-18 23:51 | 4.3M | |
![[ ]](/icons/layout.gif) | A D&D Tavern Menu.pdf | 2022-11-15 21:44 | 4.1M | |
![[ ]](/icons/layout.gif) | Badge of the 86th Battalion.pdf | 2022-11-18 23:57 | 4.0M | |
![[ ]](/icons/layout.gif) | Swordfin Games - Arena.pdf | 2022-11-18 23:51 | 4.0M | |
![[ ]](/icons/layout.gif) | Phalcon's Phenomenal Assemblage - Not Enough Magical Items I.pdf | 2022-11-15 22:15 | 3.9M | |
![[ ]](/icons/layout.gif) | Old School Hacks Vol 2 Player Roles - Campaign Management for Players and DMs.pdf | 2022-11-18 23:48 | 3.9M | |
![[ ]](/icons/unknown.gif) | Fizzleblimps Sugarland.7z | 2023-05-07 01:16 | 3.9M | |
![[ ]](/icons/layout.gif) | The Lost Tomb of the Dwarven Prince.pdf | 2022-11-15 22:15 | 3.8M | |
![[ ]](/icons/layout.gif) | A Town of Our Own.pdf | 2022-11-15 22:57 | 3.8M | |
![[ ]](/icons/layout.gif) | Magical Potion and Ingredients - Handout.pdf | 2022-11-15 22:45 | 3.8M | |
![[ ]](/icons/layout.gif) | Down & Out in Waterdeep A Level 0 Adventure.pdf | 2022-11-19 12:56 | 3.7M | |
![[ ]](/icons/layout.gif) | Shelza Ir (Drow Chess).pdf | 2022-11-19 00:34 | 3.7M | |
![[ ]](/icons/layout.gif) | House of Noctula.pdf | 2022-11-15 21:35 | 3.6M | |
![[ ]](/icons/layout.gif) | Yangzhouis Guide to Magical Items 0.12.1.pdf | 2022-11-15 21:03 | 3.5M | |
![[ ]](/icons/layout.gif) | The Legacy of the White Dragon.pdf | 2022-11-15 22:15 | 3.4M | |
![[ ]](/icons/layout.gif) | A Boy and his Modron v2.pdf | 2022-11-15 21:44 | 3.4M | |
![[ ]](/icons/layout.gif) | Faerns Vendors - A flexible vendor system for magic consumables.pdf | 2023-05-07 00:54 | 3.2M | |
![[ ]](/icons/unknown.gif) | Waterdeep in Tables v0.7.7z | 2022-11-18 23:47 | 3.1M | |
![[ ]](/icons/layout.gif) | Saltmarsh Ship Battle Maps and Sheet.pdf | 2022-11-19 00:34 | 3.1M | |
![[ ]](/icons/layout.gif) | Magnificent Magical Auction.pdf | 2022-11-15 22:12 | 3.1M | |
![[ ]](/icons/layout.gif) | Ravnica - Boros Guild Bestiary Booster.pdf | 2022-11-15 22:01 | 3.1M | |
![[ ]](/icons/layout.gif) | 25 Magic Items.pdf | 2022-11-15 21:44 | 3.0M | |
![[ ]](/icons/layout.gif) | Hand-to-Hand Combat v1.2.pdf | 2022-11-15 21:50 | 3.0M | |
![[ ]](/icons/layout.gif) | Anima Magic Items.pdf | 2022-11-19 11:57 | 2.9M | |
![[ ]](/icons/layout.gif) | Carnival of Horrors.pdf | 2022-11-18 23:50 | 2.9M | |
![[ ]](/icons/layout.gif) | Building New Races & Feats for 5th Edition.pdf | 2022-11-18 23:50 | 2.9M | |
![[ ]](/icons/layout.gif) | Kaziqueks Guide to Alchemy.pdf | 2022-11-15 21:35 | 2.8M | |
![[ ]](/icons/layout.gif) | Heres To Crime - A Guide to Capers and Heists.pdf | 2022-11-19 01:08 | 2.8M | |
![[ ]](/icons/layout.gif) | Circle of the Elementals Druid Subclass.pdf | 2023-05-07 00:57 | 2.8M | |
![[ ]](/icons/layout.gif) | Arcane Tinkerer v2.0.pdf | 2022-11-19 11:57 | 2.8M | |
![[ ]](/icons/layout.gif) | Waterdeep Expanded Faction Missions.pdf | 2022-11-19 00:00 | 2.7M | |
![[ ]](/icons/unknown.gif) | Brass Dragon Nest.PDF | 2022-11-18 23:50 | 2.7M | |
![[ ]](/icons/layout.gif) | Little Heroes - A Guide to Children at the Table.pdf | 2022-11-15 22:45 | 2.6M | |
![[ ]](/icons/layout.gif) | Realistic Shields v7.pdf | 2022-11-19 00:34 | 2.6M | |
![[ ]](/icons/layout.gif) | Essentials Sidekick Sheets v2.pdf | 2023-05-07 00:55 | 2.5M | |
![[ ]](/icons/layout.gif) | Class - The Dealer.pdf | 2023-05-07 00:57 | 2.5M | |
![[ ]](/icons/layout.gif) | Legendary Artifacts From Norse Mythology v5.pdf | 2022-11-15 23:07 | 2.5M | |
![[ ]](/icons/layout.gif) | Exotic Crafting Materials.pdf | 2023-05-07 00:54 | 2.5M | |
![[ ]](/icons/layout.gif) | Politics of Breland v1.2.pdf | 2022-11-15 22:01 | 2.4M | |
![[ ]](/icons/layout.gif) | Fat Mars Guide to Drinking.pdf | 2023-05-07 00:54 | 2.4M | |
![[ ]](/icons/layout.gif) | The Book of Dragons 2.pdf | 2022-11-15 21:04 | 2.4M | |
![[ ]](/icons/layout.gif) | Heroic Deeds Combat Enhancement v4.pdf | 2022-11-19 01:08 | 2.4M | |
![[ ]](/icons/layout.gif) | Random Encounters Sharn.pdf | 2022-11-15 22:01 | 2.3M | |
![[ ]](/icons/layout.gif) | Druid Circles For Weirdos.pdf | 2022-11-19 12:56 | 2.3M | |
![[ ]](/icons/unknown.gif) | Thomepreus Curse.7z | 2022-11-18 23:50 | 2.3M | |
![[ ]](/icons/layout.gif) | Reflectionist Class v1.1.pdf | 2022-11-19 00:34 | 2.2M | |
![[ ]](/icons/layout.gif) | Eberron Identification Papers.pdf | 2022-11-15 21:04 | 2.1M | |
![[ ]](/icons/layout.gif) | Gunslinger Class v8.2.3.pdf | 2022-11-15 21:50 | 2.1M | |
![[ ]](/icons/layout.gif) | Expanded Cantrips.pdf | 2023-05-07 00:54 | 2.1M | |
![[ ]](/icons/layout.gif) | Seasonal Surprises Vol 1.pdf | 2022-11-19 00:34 | 2.1M | |
![[ ]](/icons/layout.gif) | New Player Starter Guide.pdf | 2022-11-18 23:48 | 2.1M | |
![[ ]](/icons/layout.gif) | Tomb of the Iron King.pdf | 2022-11-15 22:28 | 2.1M | |
![[ ]](/icons/layout.gif) | Runic Roulette.pdf | 2022-11-19 00:34 | 2.1M | |
![[ ]](/icons/layout.gif) | Ravnica Guild Spells.pdf | 2022-11-19 00:35 | 2.1M | |
![[ ]](/icons/layout.gif) | The Dungeon Masters Self Defense Guide.pdf | 2022-11-15 21:45 | 2.1M | |
![[ ]](/icons/layout.gif) | The Argent Reliquary.pdf | 2022-11-15 22:18 | 1.9M | |
![[ ]](/icons/layout.gif) | The Lake Kings Wrath.pdf | 2022-11-15 22:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Duskblade.pdf | 2022-11-19 12:56 | 1.9M | |
![[ ]](/icons/layout.gif) | The Falconer.pdf | 2022-11-15 21:45 | 1.9M | |
![[ ]](/icons/layout.gif) | Dragon Coast Adventurers Guide.pdf | 2022-11-19 12:56 | 1.8M | |
![[ ]](/icons/layout.gif) | An Alphabet of Common Magic Items.pdf | 2022-11-19 11:53 | 1.8M | |
![[ ]](/icons/layout.gif) | Triumvirate Report to the Twelve.pdf | 2022-11-19 00:00 | 1.8M | |
![[ ]](/icons/layout.gif) | Destiny Abroad The Voyage of the Rose Marie.pdf | 2022-11-15 20:51 | 1.8M | |
![[ ]](/icons/layout.gif) | The Grayflags - A Tarnished Oath.pdf | 2022-11-19 12:56 | 1.8M | |
![[ ]](/icons/layout.gif) | The Gatekeeper.pdf | 2022-11-19 12:56 | 1.8M | |
![[ ]](/icons/layout.gif) | Athanaes Divinations v1.5.pdf | 2022-11-18 23:54 | 1.8M | |
![[ ]](/icons/layout.gif) | Eberron Random Events - Sharn and the Five Nations.pdf | 2022-11-15 21:04 | 1.7M | |
![[ ]](/icons/layout.gif) | Cyberpunk 5e v1.0.pdf | 2022-11-15 22:50 | 1.7M | |
![[ ]](/icons/layout.gif) | Secrets of Valeguard Spire.pdf | 2022-11-19 00:34 | 1.7M | |
![[ ]](/icons/layout.gif) | Inktober 2017 Sourcebook.pdf | 2022-11-15 21:35 | 1.7M | |
![[ ]](/icons/layout.gif) | The Factotum Class v1.2.pdf | 2022-11-15 21:45 | 1.6M | |
![[ ]](/icons/layout.gif) | The Verdantium - A Red War Roleplaying Guide v1.1.pdf | 2022-11-15 23:10 | 1.6M | |
![[ ]](/icons/layout.gif) | Expanded Combat.pdf | 2023-05-07 00:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Eberron Living Spells Collection.pdf | 2022-11-15 21:04 | 1.6M | |
![[ ]](/icons/layout.gif) | Puzzles and Riddles.pdf | 2022-11-15 22:01 | 1.6M | |
![[ ]](/icons/layout.gif) | Poisons for 5th Edition.pdf | 2022-11-15 22:01 | 1.5M | |
![[ ]](/icons/layout.gif) | HH-DJS01-02 The House Always Wins.pdf | 2022-11-19 01:08 | 1.5M | |
![[ ]](/icons/layout.gif) | Social Combat.pdf | 2023-05-07 00:16 | 1.5M | |
![[ ]](/icons/layout.gif) | Crafting Magical Weapons.pdf | 2022-11-15 22:50 | 1.5M | |
![[ ]](/icons/layout.gif) | The Claw of Winter.pdf | 2022-11-15 21:45 | 1.5M | |
![[ ]](/icons/layout.gif) | Droops Dilemma.pdf | 2022-11-19 12:56 | 1.5M | |
![[ ]](/icons/layout.gif) | Ravenloft Ruleset.pdf | 2022-11-15 22:01 | 1.5M | |
![[ ]](/icons/layout.gif) | To Hit Armor Class 0.pdf | 2022-11-18 23:50 | 1.5M | |
![[ ]](/icons/layout.gif) | The Undying.pdf | 2022-11-15 23:10 | 1.5M | |
![[ ]](/icons/layout.gif) | 45 Crafting Materials for 5e.pdf | 2022-11-15 21:44 | 1.4M | |
![[ ]](/icons/layout.gif) | Cardinal Guardians Warlock Patrons.pdf | 2022-11-18 23:50 | 1.4M | |
![[ ]](/icons/layout.gif) | Homebrewing Cantrips v1.01.pdf | 2022-11-19 01:08 | 1.4M | |
![[ ]](/icons/layout.gif) | Rage from Beyond.pdf | 2022-11-15 22:01 | 1.4M | |
![[ ]](/icons/layout.gif) | The Perilous Pact Final v2.2.pdf | 2022-11-18 23:48 | 1.4M | |
![[ ]](/icons/layout.gif) | Homebrewing Weapons v1.01.pdf | 2022-11-19 01:08 | 1.4M | |
![[ ]](/icons/layout.gif) | Aunt Lobelias Revenge.pdf | 2022-11-18 23:54 | 1.4M | |
![[ ]](/icons/layout.gif) | The Tricksters Tower.pdf | 2022-11-15 23:10 | 1.3M | |
![[ ]](/icons/layout.gif) | Gunslinger Revised.pdf | 2022-11-15 21:50 | 1.3M | |
![[ ]](/icons/layout.gif) | Grapplers Handbook - Implement Sai.pdf | 2022-11-19 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | Fells Fabulous Magical Transfomations.pdf | 2023-05-07 01:16 | 1.3M | |
![[ ]](/icons/layout.gif) | A Players Crash Course to Ravnica.pdf | 2022-11-19 00:02 | 1.3M | |
![[ ]](/icons/layout.gif) | D&D 5e Player Cheet Sheet v8.pdf | 2022-11-15 23:10 | 1.3M | |
![[ ]](/icons/layout.gif) | Companion Spells.pdf | 2023-05-07 01:56 | 1.3M | |
![[ ]](/icons/layout.gif) | Languages of Eberron.pdf | 2022-11-15 23:07 | 1.2M | |
![[ ]](/icons/layout.gif) | Collection of Adventurers Leagues Backgrounds v0.9.pdf | 2023-05-07 01:56 | 1.2M | |
![[ ]](/icons/layout.gif) | Magical Cosmetics.pdf | 2022-11-15 22:45 | 1.2M | |
![[ ]](/icons/layout.gif) | The Ancient Dragon Warlock Patron.pdf | 2022-11-15 22:18 | 1.2M | |
![[ ]](/icons/layout.gif) | Improved Crafting Herbalism.pdf | 2022-11-15 21:35 | 1.2M | |
![[ ]](/icons/layout.gif) | HH-DJS01-01 Pest Extermination.pdf | 2022-11-19 01:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Simple Uncommon Magic Weapons.pdf | 2023-05-07 02:10 | 1.2M | |
![[ ]](/icons/layout.gif) | Wanted Scores.pdf | 2022-11-19 00:00 | 1.1M | |
![[ ]](/icons/layout.gif) | Step-by-Step Pet Companions.pdf | 2023-05-07 00:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Truly Wild Magic.pdf | 2022-11-19 00:00 | 1.1M | |
![[ ]](/icons/layout.gif) | Rumble at the Yawning Portal.pdf | 2022-11-19 00:34 | 1.1M | |
![[ ]](/icons/layout.gif) | Champions of the Blood War - Oath of the Abyss v1.0.pdf | 2022-11-18 23:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Baltezaars Book Builder.pdf | 2022-11-18 23:57 | 1.1M | |
![[ ]](/icons/layout.gif) | Children of Qotal.pdf | 2022-11-18 23:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Artificer Class v2.pdf | 2022-11-18 23:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Death Rule Alterations.pdf | 2022-11-18 23:54 | 1.1M | |
![[ ]](/icons/layout.gif) | One Night in the City.pdf | 2022-11-18 23:48 | 1.1M | |
![[ ]](/icons/layout.gif) | The Haunt of Hightower A Ravnica One-Shot.pdf | 2022-11-19 12:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Expanded Sailing v1.1.pdf | 2023-05-07 00:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Encounters in the Mists - Additional Rrandom Encounters for Dungeon Masters.pdf | 2022-11-18 23:58 | 1.0M | |
![[ ]](/icons/layout.gif) | Symbols to Represent the 8 Schools of Magic.pdf | 2022-11-18 23:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Everlasting Order.pdf | 2023-05-07 00:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Cosmic Archetypes.pdf | 2022-11-15 22:50 | 1.0M | |
![[ ]](/icons/layout.gif) | New Neighbors v1.pdf | 2022-11-18 23:48 | 1.0M | |
![[ ]](/icons/layout.gif) | The Big Book of Rogues.pdf | 2022-11-15 21:04 | 1.0M | |
![[ ]](/icons/layout.gif) | Eilistraee Sword Dancer Domain.pdf | 2022-11-15 21:04 | 969K | |
![[ ]](/icons/layout.gif) | Temple of the Dragonknights.pdf | 2022-11-18 23:51 | 946K | |
![[ ]](/icons/layout.gif) | 5e Brewing Guide.pdf | 2022-11-15 21:44 | 895K | |
![[ ]](/icons/layout.gif) | Way of the Elements - Revised Monastic Tradition.pdf | 2022-11-18 23:47 | 882K | |
![[ ]](/icons/layout.gif) | Min-Max Monsters in the Lost Mine of Phandelver.pdf | 2022-11-15 21:00 | 880K | |
![[ ]](/icons/layout.gif) | Drow of Vyxhiar Part 1 - Herding Rothe.pdf | 2022-11-19 12:56 | 867K | |
![[ ]](/icons/layout.gif) | Elminsters Guide to Solo Adventuring.pdf | 2022-11-19 12:56 | 858K | |
![[ ]](/icons/layout.gif) | Sights and Sounds of Ravnica.pdf | 2023-05-07 02:10 | 856K | |
![[ ]](/icons/layout.gif) | Trick Arrrows - Basic Edition.pdf | 2022-11-19 00:00 | 848K | |
![[ ]](/icons/compressed.gif) | D&D 5e Token Marker Set for Roll20net VTT.zip | 2022-11-15 23:10 | 824K | |
![[ ]](/icons/layout.gif) | Fusilist (Artificer Specialist).pdf | 2022-11-18 23:53 | 794K | |
![[ ]](/icons/layout.gif) | D&D Denizens Goblins.pdf | 2022-11-15 23:10 | 764K | |
![[ ]](/icons/layout.gif) | Sword Saints - Lore of the Eastern Lands v1.2.pdf | 2022-11-18 23:51 | 763K | |
![[ ]](/icons/layout.gif) | Circle of the Lycan.pdf | 2023-05-07 00:57 | 763K | |
![[ ]](/icons/layout.gif) | Cleric Domain - Winter.pdf | 2023-05-07 00:57 | 725K | |
![[ ]](/icons/layout.gif) | Dodecronomicon Presents The Drowning Deep.pdf | 2022-11-15 20:52 | 712K | |
![[ ]](/icons/layout.gif) | Improved Travel.pdf | 2022-11-15 21:35 | 710K | |
![[ ]](/icons/layout.gif) | Class - The Summoner.pdf | 2023-05-07 00:57 | 707K | |
![[ ]](/icons/layout.gif) | Kye You - The Deck of Many More Things.pdf | 2022-11-15 21:35 | 673K | |
![[ ]](/icons/layout.gif) | Doppelganger.pdf | 2022-11-19 12:56 | 672K | |
![[ ]](/icons/layout.gif) | Festival Guide.pdf | 2023-05-07 01:16 | 666K | |
![[ ]](/icons/layout.gif) | Death Stalker, A Ranger Archetype.pdf | 2022-11-18 23:54 | 655K | |
![[ ]](/icons/layout.gif) | Warlock Patron, Lady Luck.pdf | 2022-11-19 00:00 | 653K | |
![[ ]](/icons/layout.gif) | Living Spells.pdf | 2022-11-15 22:45 | 651K | |
![[ ]](/icons/layout.gif) | The Spontaneous Dungeon Master.pdf | 2022-11-15 23:10 | 630K | |
![[ ]](/icons/layout.gif) | Lycan Race.pdf | 2022-11-15 22:45 | 610K | |
![[ ]](/icons/layout.gif) | 18 Extra Feats.pdf | 2022-11-15 21:44 | 607K | |
![[ ]](/icons/layout.gif) | Druid Circle of The Spirit Warriors.pdf | 2022-11-19 12:56 | 596K | |
![[ ]](/icons/layout.gif) | Artificer Class Guide v1.pdf | 2022-11-18 23:54 | 588K | |
![[ ]](/icons/layout.gif) | Rossos Guide to Organized Play in Waterdeep.pdf | 2022-11-19 00:34 | 578K | |
![[ ]](/icons/layout.gif) | Alchemist.pdf | 2022-11-15 22:57 | 573K | |
![[ ]](/icons/layout.gif) | The Sorcerer and the Weave.pdf | 2022-11-15 23:10 | 571K | |
![[ ]](/icons/layout.gif) | Optional Rules Being a Parent.pdf | 2022-11-15 22:15 | 566K | |
![[ ]](/icons/layout.gif) | Character Generation Quick Reference.pdf | 2022-11-18 23:50 | 562K | |
![[ ]](/icons/layout.gif) | DnD 5e For HarnWorld Rules.pdf | 2022-11-15 20:51 | 553K | |
![[ ]](/icons/layout.gif) | The Dragon Knight Class.pdf | 2022-11-15 21:45 | 530K | |
![[ ]](/icons/layout.gif) | Superior Artificer.pdf | 2022-11-18 23:51 | 525K | |
![[ ]](/icons/layout.gif) | Cosmetic Magic.pdf | 2022-11-15 22:50 | 513K | |
![[ ]](/icons/layout.gif) | Life After Death - A way to Deal with Player Death.pdf | 2022-11-15 23:07 | 473K | |
![[ ]](/icons/layout.gif) | Tavern Games.pdf | 2022-11-18 23:51 | 471K | |
![[ ]](/icons/layout.gif) | Barbarian Path - The Savage.pdf | 2022-11-18 23:57 | 456K | |
![[ ]](/icons/layout.gif) | PvP Fighting Arena Adventure, Syndicates & Ichor Pits.pdf | 2022-11-15 22:01 | 456K | |
![[ ]](/icons/layout.gif) | Path of The Hero.pdf | 2022-11-15 22:15 | 452K | |
![[ ]](/icons/layout.gif) | Ravnica Guild Summaries.pdf | 2022-11-19 00:34 | 434K | |
![[ ]](/icons/layout.gif) | Sorcerous Origin - Fey Enchanter.pdf | 2023-05-07 00:16 | 408K | |
![[ ]](/icons/layout.gif) | Quest Tracker.pdf | 2022-11-15 22:01 | 402K | |
![[ ]](/icons/layout.gif) | The Book of Ki - Technique Index.pdf | 2022-11-15 21:04 | 373K | |
![[ ]](/icons/layout.gif) | The Dungeon Master.pdf | 2022-11-15 21:45 | 372K | |
![[ ]](/icons/layout.gif) | Dungeons & Dragons Drinking Games.pdf | 2022-11-19 12:56 | 366K | |
![[ ]](/icons/layout.gif) | Red Hand of Doom - 5E Conversion Guide.pdf | 2022-11-19 00:34 | 346K | |
![[ ]](/icons/layout.gif) | Tavernen und Glucksspiele (GER).pdf | 2022-11-18 23:51 | 339K | |
![[ ]](/icons/layout.gif) | Lair of the Flame Revenant v2.pdf | 2022-11-15 23:06 | 325K | |
![[ ]](/icons/layout.gif) | The Artificers Handbook.pdf | 2022-11-15 22:18 | 294K | |
![[ ]](/icons/layout.gif) | D&D Item Cards - Form Fillable.pdf | 2022-11-15 23:10 | 285K | |
![[ ]](/icons/layout.gif) | Recipe Crafting for Consumables.pdf | 2022-11-19 00:34 | 284K | |
![[ ]](/icons/layout.gif) | DMConsole 100 NPC List.pdf | 2022-11-15 20:51 | 271K | |
![[ ]](/icons/layout.gif) | Magic Items - Flayor-Made-Clothes.pdf | 2022-11-15 22:45 | 267K | |
![[ ]](/icons/layout.gif) | Realmspace Revisited.pdf | 2022-11-19 00:34 | 241K | |
![[ ]](/icons/layout.gif) | Equipment Durability and Quality.pdf | 2023-05-07 00:54 | 199K | |
![[ ]](/icons/layout.gif) | Consolidated Downtime Activities.pdf | 2023-05-07 02:18 | 178K | |
![[ ]](/icons/layout.gif) | Monster Statblocks.pdf | 2022-11-15 23:05 | 175K | |
![[ ]](/icons/layout.gif) | Civilized Magic.pdf | 2023-05-07 00:57 | 171K | |
![[ ]](/icons/layout.gif) | The Awakened One, An Otherworldly Patron.pdf | 2022-11-15 22:18 | 167K | |
![[ ]](/icons/layout.gif) | 6 Extra Diseases.pdf | 2022-11-15 21:44 | 161K | |
![[ ]](/icons/layout.gif) | Blood of the Oracle, Sorcerer Origin.pdf | 2022-11-18 23:57 | 159K | |
![[ ]](/icons/layout.gif) | Flavorful Infusions, Additional Infusions for the Revised Artificer.pdf | 2023-05-07 01:16 | 157K | |
![[ ]](/icons/layout.gif) | Festive Blood Hunters.pdf | 2023-05-07 01:16 | 154K | |
![[ ]](/icons/layout.gif) | fryLog Season 8 Log v007.pdf | 2022-11-15 21:52 | 123K | |
![[ ]](/icons/layout.gif) | Mastercrafted Gear v10.pdf | 2022-11-15 21:00 | 95K | |
![[ ]](/icons/layout.gif) | 5e Crafting Potions and Poisons.pdf | 2022-11-15 21:44 | 92K | |
![[ ]](/icons/layout.gif) | Path of the Slayer.pdf | 2022-11-15 22:15 | 92K | |
![[ ]](/icons/layout.gif) | Player Goals.pdf | 2022-11-19 11:41 | 84K | |
![[ ]](/icons/layout.gif) | The Noodle Shop.pdf | 2022-11-15 22:15 | 79K | |
![[ ]](/icons/layout.gif) | fryLog Season 8 Log v007 - Bonus Sheet.pdf | 2022-11-15 21:52 | 57K | |
![[ ]](/icons/layout.gif) | fryLog Buyers Guide v007.pdf | 2022-11-15 21:52 | 40K | |
![[ ]](/icons/unknown.gif) | Symbols to Represent the 8 Schools of Magic Fonts.7z | 2022-11-18 23:51 | 33K | |
|